C25H29N7O4 — CID 158609156
1-[2-[[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]methyl]pyrimidin-4-yl]-3-(trideuteriomethyl)benzimidazol-2-one (PubChem CID 158609156) has the molecular formula C25H29N7O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is 1-[2-[[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]methyl]pyrimidin-4-yl]-3-(trideuteriomethyl)benzimidazol-2-one.
| Compound Name | 1-[2-[[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]methyl]pyrimidin-4-yl]-3-(trideuteriomethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 158609156 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-[2-[[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]methyl]pyrimidin-4-yl]-3-(trideuteriomethyl)benzimidazol-2-one |
| SMILES | [2H]C([2H])([2H])n1c(=O)n(-c2ccnc(Cc3cc([N+](=O)[O-])c(N(C)CCN(C)C)cc3OC)n2)c2ccccc21 |
| InChI | InChI=1S/C25H29N7O4/c1-28(2)12-13-29(3)20-16-22(36-5)17(14-21(20)32(34)35)15-23-26-11-10-24(27-23)31-19-9-7-6-8-18(19)30(4)25(31)33/h6-11,14,16H,12-13,15H2,1-5H3/i4D3 |
| InChIKey | SOIZIKJSNFNJKV-GKOSEXJESA-N |
| XLogP | 2.62 |
| TPSA | 111.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|