About 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea
1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea (PubChem CID 158610459) has the molecular formula C21H24N4O3S
and a molecular weight of 412.52 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea.
Molecular Properties
| Compound Name | 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea |
| PubChem CID | 158610459 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea |
| SMILES | CCCS(=O)(=O)c1ccc(-c2ccccc2)c(NC(=O)Nc2cc(C)n(C)n2)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-4-12-29(27,28)17-10-11-18(16-8-6-5-7-9-16)19(14-17)22-21(26)23-20-13-15(2)25(3)24-20/h5-11,13-14H,4,12H2,1-3H3,(H2,22,23,24,26) |
| InChIKey | QMKBKXUWSMGJRT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea?
The IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea (CID 158610459) is 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea.
What is the SMILES notation for 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea?
The canonical SMILES for 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea is CCCS(=O)(=O)c1ccc(-c2ccccc2)c(NC(=O)Nc2cc(C)n(C)n2)c1.
What is the InChIKey of 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea?
The InChIKey is QMKBKXUWSMGJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O3S/c1-4-12-29(27,28)17-10-11-18(16-8-6-5-7-9-16)19(14-17)22-21(26)23-20-13-15(2)25(3)24-20/h5-11,13-14H,4,12H2,1-3H3,(H2,22,23,24,26).
What are the key properties of 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea?
1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea has a molecular weight of 412.52 g/mol, XLogP of 4.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethylpyrazol-3-yl)-3-(2-phenyl-5-propylsulfonylphenyl)urea is sourced from PubChem (CID 158610459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).