C25H26N2O2 — CID 158612443
1,3-dimethyl-5-[6-methylidene-4-[(1S)-1-pyridin-2-ylethoxy]-7,8-dihydro-5H-naphthalen-2-yl]pyridin-2-one (PubChem CID 158612443) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,3-dimethyl-5-[6-methylidene-4-[(1S)-1-pyridin-2-ylethoxy]-7,8-dihydro-5H-naphthalen-2-yl]pyridin-2-one.
| Compound Name | 1,3-dimethyl-5-[6-methylidene-4-[(1S)-1-pyridin-2-ylethoxy]-7,8-dihydro-5H-naphthalen-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 158612443 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1,3-dimethyl-5-[6-methylidene-4-[(1S)-1-pyridin-2-ylethoxy]-7,8-dihydro-5H-naphthalen-2-yl]pyridin-2-one |
| SMILES | C=C1CCc2cc(-c3cc(C)c(=O)n(C)c3)cc(O[C@@H](C)c3ccccn3)c2C1 |
| InChI | InChI=1S/C25H26N2O2/c1-16-8-9-19-13-20(21-12-17(2)25(28)27(4)15-21)14-24(22(19)11-16)29-18(3)23-7-5-6-10-26-23/h5-7,10,12-15,18H,1,8-9,11H2,2-4H3/t18-/m0/s1 |
| InChIKey | NTDJSFVXOCMOMQ-SFHVURJKSA-N |
| XLogP | 4.94 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|