C18H23NO3 — CID 145148169
4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane (PubChem CID 145148169) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane.
| Compound Name | 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane |
|---|---|
| PubChem CID | 145148169 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane |
| SMILES | CC.COc1cc(-c2cc(C)c(=O)n(C)c2)cc(C)c1C=O |
| InChI | InChI=1S/C16H17NO3.C2H6/c1-10-5-12(7-15(20-4)14(10)9-18)13-6-11(2)16(19)17(3)8-13;1-2/h5-9H,1-4H3;1-2H3 |
| InChIKey | OXEGFAFBYYKXRL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|