About 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane
4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane (PubChem CID 145148169) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane.
Molecular Properties
| Compound Name | 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane |
| PubChem CID | 145148169 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane |
| SMILES | CC.COc1cc(-c2cc(C)c(=O)n(C)c2)cc(C)c1C=O |
| InChI | InChI=1S/C16H17NO3.C2H6/c1-10-5-12(7-15(20-4)14(10)9-18)13-6-11(2)16(19)17(3)8-13;1-2/h5-9H,1-4H3;1-2H3 |
| InChIKey | OXEGFAFBYYKXRL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane?
The IUPAC name of 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane (CID 145148169) is 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane.
What is the SMILES notation for 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane?
The canonical SMILES for 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane is CC.COc1cc(-c2cc(C)c(=O)n(C)c2)cc(C)c1C=O.
What is the InChIKey of 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane?
The InChIKey is OXEGFAFBYYKXRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3.C2H6/c1-10-5-12(7-15(20-4)14(10)9-18)13-6-11(2)16(19)17(3)8-13;1-2/h5-9H,1-4H3;1-2H3.
What are the key properties of 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane?
4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane has a molecular weight of 301.39 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-methoxy-6-methylbenzaldehyde;ethane is sourced from PubChem (CID 145148169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).