About 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate
1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate (PubChem CID 158613294) has the molecular formula C13H22F6O7
and a molecular weight of 404.30 g/mol. Its IUPAC name is 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate |
| PubChem CID | 158613294 |
| Molecular Formula | C13H22F6O7 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate |
| SMILES | CC(=O)OC(C)COC(F)(F)F.CC(=O)OC(F)(F)F.COCC(C)O |
| InChI | InChI=1S/C6H9F3O3.C4H10O2.C3H3F3O2/c1-4(12-5(2)10)3-11-6(7,8)9;1-4(5)3-6-2;1-2(7)8-3(4,5)6/h4H,3H2,1-2H3;4-5H,3H2,1-2H3;1H3 |
| InChIKey | HXCDPCNKPFLECL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate?
The IUPAC name of 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate (CID 158613294) is 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate.
What is the SMILES notation for 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate?
The canonical SMILES for 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate is CC(=O)OC(C)COC(F)(F)F.CC(=O)OC(F)(F)F.COCC(C)O.
What is the InChIKey of 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate?
The InChIKey is HXCDPCNKPFLECL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O3.C4H10O2.C3H3F3O2/c1-4(12-5(2)10)3-11-6(7,8)9;1-4(5)3-6-2;1-2(7)8-3(4,5)6/h4H,3H2,1-2H3;4-5H,3H2,1-2H3;1H3.
What are the key properties of 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate?
1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate has a molecular weight of 404.30 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-ol;1-(trifluoromethoxy)propan-2-yl acetate;trifluoromethyl acetate is sourced from PubChem (CID 158613294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).