About 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate
1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate (PubChem CID 159744680) has the molecular formula C26H54O6
and a molecular weight of 462.71 g/mol. Its IUPAC name is 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate.
Molecular Properties
| Compound Name | 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate |
| PubChem CID | 159744680 |
| Molecular Formula | C26H54O6 |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate |
| SMILES | CCCCCC(C)=O.CCCCCCCCCCOCC(C)O.COCC(C)OC(C)=O |
| InChI | InChI=1S/C13H28O2.C7H14O.C6H12O3/c1-3-4-5-6-7-8-9-10-11-15-12-13(2)14;1-3-4-5-6-7(2)8;1-5(4-8-3)9-6(2)7/h13-14H,3-12H2,1-2H3;3-6H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | NCWXUIZBSIXZQK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate?
The IUPAC name of 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate (CID 159744680) is 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate.
What is the SMILES notation for 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate?
The canonical SMILES for 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate is CCCCCC(C)=O.CCCCCCCCCCOCC(C)O.COCC(C)OC(C)=O.
What is the InChIKey of 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate?
The InChIKey is NCWXUIZBSIXZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2.C7H14O.C6H12O3/c1-3-4-5-6-7-8-9-10-11-15-12-13(2)14;1-3-4-5-6-7(2)8;1-5(4-8-3)9-6(2)7/h13-14H,3-12H2,1-2H3;3-6H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate?
1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate has a molecular weight of 462.71 g/mol, XLogP of 6.26, 18 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decoxypropan-2-ol;heptan-2-one;1-methoxypropan-2-yl acetate is sourced from PubChem (CID 159744680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).