C28H23IrN2- — CID 158614986
iridium;3-methylbenzo[h]quinoline;3-methyl-6,10-dihydro-5H-benzo[h]quinolin-10-ide (PubChem CID 158614986) has the molecular formula C28H23IrN2- and a molecular weight of 579.72 g/mol. Its IUPAC name is iridium;3-methylbenzo[h]quinoline;3-methyl-6,10-dihydro-5H-benzo[h]quinolin-10-ide.
| Compound Name | iridium;3-methylbenzo[h]quinoline;3-methyl-6,10-dihydro-5H-benzo[h]quinolin-10-ide |
|---|---|
| PubChem CID | 158614986 |
| Molecular Formula | C28H23IrN2- |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | iridium;3-methylbenzo[h]quinoline;3-methyl-6,10-dihydro-5H-benzo[h]quinolin-10-ide |
| SMILES | Cc1cnc2c(c1)CCc1ccc[c-]c1-2.Cc1cnc2c(ccc3ccccc32)c1.[Ir] |
| InChI | InChI=1S/C14H12N.C14H11N.Ir/c2*1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)15-9-10;/h2-4,8-9H,6-7H2,1H3;2-9H,1H3;/q-1;; |
| InChIKey | ILQLVQBRSCYMHG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|