C21H26O7 — CID 158616945
[(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] 2-[4-(acetyloxymethyl)-2-(3-oxobutyl)phenyl]acetate (PubChem CID 158616945) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] 2-[4-(acetyloxymethyl)-2-(3-oxobutyl)phenyl]acetate.
| Compound Name | [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] 2-[4-(acetyloxymethyl)-2-(3-oxobutyl)phenyl]acetate |
|---|---|
| PubChem CID | 158616945 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] 2-[4-(acetyloxymethyl)-2-(3-oxobutyl)phenyl]acetate |
| SMILES | CC(=O)CCc1cc(COC(C)=O)ccc1CC(=O)OC1/C=C\COCOC1 |
| InChI | InChI=1S/C21H26O7/c1-15(22)5-7-18-10-17(12-27-16(2)23)6-8-19(18)11-21(24)28-20-4-3-9-25-14-26-13-20/h3-4,6,8,10,20H,5,7,9,11-14H2,1-2H3/b4-3- |
| InChIKey | YDBYDNLMMPYVNU-ARJAWSKDSA-N |
| XLogP | 2.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|