C25H36N2O5 — CID 162138617
[(2E)-cyclooct-2-en-1-yl] 2-[4-(acetyloxymethyl)-2-[(6-amino-6-oxohexyl)amino]phenyl]acetate (PubChem CID 162138617) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(2E)-cyclooct-2-en-1-yl] 2-[4-(acetyloxymethyl)-2-[(6-amino-6-oxohexyl)amino]phenyl]acetate.
| Compound Name | [(2E)-cyclooct-2-en-1-yl] 2-[4-(acetyloxymethyl)-2-[(6-amino-6-oxohexyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 162138617 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [(2E)-cyclooct-2-en-1-yl] 2-[4-(acetyloxymethyl)-2-[(6-amino-6-oxohexyl)amino]phenyl]acetate |
| SMILES | CC(=O)OCc1ccc(CC(=O)OC2/C=C\CCCCC2)c(NCCCCCC(N)=O)c1 |
| InChI | InChI=1S/C25H36N2O5/c1-19(28)31-18-20-13-14-21(23(16-20)27-15-9-5-8-12-24(26)29)17-25(30)32-22-10-6-3-2-4-7-11-22/h6,10,13-14,16,22,27H,2-5,7-9,11-12,15,17-18H2,1H3,(H2,26,29)/b10-6- |
| InChIKey | JXZQLFNPAPCGOU-POHAHGRESA-N |
| XLogP | 4.18 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|