C58H46BClN4O2 — CID 158623072
2-(3-chlorophenyl)-4-(4-phenylphenyl)quinazoline;4-(4-phenylphenyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline (PubChem CID 158623072) has the molecular formula C58H46BClN4O2 and a molecular weight of 877.30 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-(4-phenylphenyl)quinazoline;4-(4-phenylphenyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline.
| Compound Name | 2-(3-chlorophenyl)-4-(4-phenylphenyl)quinazoline;4-(4-phenylphenyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
|---|---|
| PubChem CID | 158623072 |
| Molecular Formula | C58H46BClN4O2 |
| Molecular Weight | 877.30 g/mol |
| Exact Mass | 876.34 |
| IUPAC Name | 2-(3-chlorophenyl)-4-(4-phenylphenyl)quinazoline;4-(4-phenylphenyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4ccc(-c5ccccc5)cc4)c4ccccc4n3)c2)OC1(C)C.Clc1cccc(-c2nc(-c3ccc(-c4ccccc4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C32H29BN2O2.C26H17ClN2/c1-31(2)32(3,4)37-33(36-31)26-14-10-13-25(21-26)30-34-28-16-9-8-15-27(28)29(35-30)24-19-17-23(18-20-24)22-11-6-5-7-12-22;27-22-10-6-9-21(17-22)26-28-24-12-5-4-11-23(24)25(29-26)20-15-13-19(14-16-20)18-7-2-1-3-8-18/h5-21H,1-4H3;1-17H |
| InChIKey | HYFZJPWBXCJAAS-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.30 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|