C13H18BF5O2S — CID 158624868
pentafluoro-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane (PubChem CID 158624868) has the molecular formula C13H18BF5O2S and a molecular weight of 344.15 g/mol. Its IUPAC name is pentafluoro-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 158624868 |
| Molecular Formula | C13H18BF5O2S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | pentafluoro-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C13H18BF5O2S/c1-9-6-10(8-11(7-9)22(15,16,17,18)19)14-20-12(2,3)13(4,5)21-14/h6-8H,1-5H3 |
| InChIKey | QAKMUNDDIGZMCN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|