C39H47B3O6 — CID 89063635
4,4,5,5-tetramethyl-2-[5-methyl-8,11-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)perylen-2-yl]-1,3,2-dioxaborolane (PubChem CID 89063635) has the molecular formula C39H47B3O6 and a molecular weight of 644.24 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5-methyl-8,11-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)perylen-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[5-methyl-8,11-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)perylen-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89063635 |
| Molecular Formula | C39H47B3O6 |
| Molecular Weight | 644.24 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5-methyl-8,11-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)perylen-2-yl]-1,3,2-dioxaborolane |
| SMILES | Cc1cc2cc(B3OC(C)(C)C(C)(C)O3)cc3c4cc(B5OC(C)(C)C(C)(C)O5)cc5cc(B6OC(C)(C)C(C)(C)O6)cc(c(c1)c23)c54 |
| InChI | InChI=1S/C39H47B3O6/c1-22-14-23-16-25(40-43-34(2,3)35(4,5)44-40)20-30-31-21-27(42-47-38(10,11)39(12,13)48-42)18-24-17-26(41-45-36(6,7)37(8,9)46-41)19-29(33(24)31)28(15-22)32(23)30/h14-21H,1-13H3 |
| InChIKey | XZCJGNRTGHXOHP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.24 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|