C42H55BO2 — CID 90808425
2-[8,11-ditert-butyl-5-(2,5-dimethylhexan-2-yl)perylen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90808425) has the molecular formula C42H55BO2 and a molecular weight of 602.71 g/mol. Its IUPAC name is 2-[8,11-ditert-butyl-5-(2,5-dimethylhexan-2-yl)perylen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[8,11-ditert-butyl-5-(2,5-dimethylhexan-2-yl)perylen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90808425 |
| Molecular Formula | C42H55BO2 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.43 |
| IUPAC Name | 2-[8,11-ditert-butyl-5-(2,5-dimethylhexan-2-yl)perylen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)CCC(C)(C)c1cc2cc(B3OC(C)(C)C(C)(C)O3)cc3c4cc(C(C)(C)C)cc5cc(C(C)(C)C)cc(c(c1)c23)c54 |
| InChI | InChI=1S/C42H55BO2/c1-25(2)15-16-40(9,10)30-19-27-20-31(43-44-41(11,12)42(13,14)45-43)24-35-33-22-29(39(6,7)8)18-26-17-28(38(3,4)5)21-32(36(26)33)34(23-30)37(27)35/h17-25H,15-16H2,1-14H3 |
| InChIKey | BQUQCIQICPDIEW-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|