C39H61BO2 — CID 90850233
2-[5,10-ditert-butyl-8-methyl-7-(2,3,3-trimethylbutyl)-7a,8,9,10,11,11a-hexahydro-7H-benzo[a]phenalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90850233) has the molecular formula C39H61BO2 and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-[5,10-ditert-butyl-8-methyl-7-(2,3,3-trimethylbutyl)-7a,8,9,10,11,11a-hexahydro-7H-benzo[a]phenalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5,10-ditert-butyl-8-methyl-7-(2,3,3-trimethylbutyl)-7a,8,9,10,11,11a-hexahydro-7H-benzo[a]phenalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90850233 |
| Molecular Formula | C39H61BO2 |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.48 |
| IUPAC Name | 2-[5,10-ditert-butyl-8-methyl-7-(2,3,3-trimethylbutyl)-7a,8,9,10,11,11a-hexahydro-7H-benzo[a]phenalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CC(C(C)(C)C)CC2c3cc(B4OC(C)(C)C(C)(C)O4)cc4cc(C(C)(C)C)cc(c34)C(CC(C)C(C)(C)C)C12 |
| InChI | InChI=1S/C39H61BO2/c1-23-16-26(36(6,7)8)20-30-32-22-28(40-41-38(12,13)39(14,15)42-40)19-25-18-27(37(9,10)11)21-31(34(25)32)29(33(23)30)17-24(2)35(3,4)5/h18-19,21-24,26,29-30,33H,16-17,20H2,1-15H3 |
| InChIKey | QNFYBFJLUJUZEG-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|