C58H40BrN9O8 — CID 158626239
3-bromo-5,6-dinitro-1-tritylindazole;3-(2-methyl-4-pyridinyl)-5,6-dinitro-1-tritylindazole (PubChem CID 158626239) has the molecular formula C58H40BrN9O8 and a molecular weight of 1070.92 g/mol. Its IUPAC name is 3-bromo-5,6-dinitro-1-tritylindazole;3-(2-methyl-4-pyridinyl)-5,6-dinitro-1-tritylindazole.
| Compound Name | 3-bromo-5,6-dinitro-1-tritylindazole;3-(2-methyl-4-pyridinyl)-5,6-dinitro-1-tritylindazole |
|---|---|
| PubChem CID | 158626239 |
| Molecular Formula | C58H40BrN9O8 |
| Molecular Weight | 1070.92 g/mol |
| Exact Mass | 1069.22 |
| IUPAC Name | 3-bromo-5,6-dinitro-1-tritylindazole;3-(2-methyl-4-pyridinyl)-5,6-dinitro-1-tritylindazole |
| SMILES | Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3cc([N+](=O)[O-])c([N+](=O)[O-])cc23)ccn1.O=[N+]([O-])c1cc2c(Br)nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H23N5O4.C26H17BrN4O4/c1-22-19-23(17-18-33-22)31-27-20-29(36(38)39)30(37(40)41)21-28(27)35(34-31)32(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;27-25-21-16-23(30(32)33)24(31(34)35)17-22(21)29(28-25)26(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h2-21H,1H3;1-17H |
| InChIKey | HYPVZBUGSGYQBJ-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 221.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.92 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|