C25H31N3O5 — CID 158629693
(1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxamide;(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 158629693) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxamide;(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxamide;(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 158629693 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxamide;(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(=O)O)c2ccccc21.NC(=O)[C@@H]1C[C@H](N)c2ccccc21 |
| InChI | InChI=1S/C15H19NO4.C10H12N2O/c1-15(2,3)20-14(19)16-12-8-11(13(17)18)9-6-4-5-7-10(9)12;11-9-5-8(10(12)13)6-3-1-2-4-7(6)9/h4-7,11-12H,8H2,1-3H3,(H,16,19)(H,17,18);1-4,8-9H,5,11H2,(H2,12,13)/t11-,12+;8-,9+/m11/s1 |
| InChIKey | HZAOGTDGFVAYDB-AJCKVBDHSA-N |
| XLogP | 3.48 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |