C40H32F3N7O2S — CID 158630510
21,22-dihydroporphyrin;2-(1-methylimidazol-4-yl)sulfonyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 158630510) has the molecular formula C40H32F3N7O2S and a molecular weight of 731.80 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;2-(1-methylimidazol-4-yl)sulfonyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 21,22-dihydroporphyrin;2-(1-methylimidazol-4-yl)sulfonyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 158630510 |
| Molecular Formula | C40H32F3N7O2S |
| Molecular Weight | 731.80 g/mol |
| Exact Mass | 731.23 |
| IUPAC Name | 21,22-dihydroporphyrin;2-(1-methylimidazol-4-yl)sulfonyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.Cn1cnc(S(=O)(=O)N2CCc3ccc(-c4ccc(C(F)(F)F)cc4)cc3C2)c1 |
| InChI | InChI=1S/C20H18F3N3O2S.C20H14N4/c1-25-12-19(24-13-25)29(27,28)26-9-8-15-2-3-16(10-17(15)11-26)14-4-6-18(7-5-14)20(21,22)23;1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h2-7,10,12-13H,8-9,11H2,1H3;1-12,21-22H/b;13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | VMHHZLKGQWRQSG-ZCWAEKNJSA-N |
| XLogP | 8.51 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.80 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |