C18H24ClNO5 — CID 158630656
3-acetylbicyclo[1.1.1]pentane-1-carbonyl chloride;3-acetyl-N-methoxy-N-methylbicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 158630656) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-acetylbicyclo[1.1.1]pentane-1-carbonyl chloride;3-acetyl-N-methoxy-N-methylbicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-acetylbicyclo[1.1.1]pentane-1-carbonyl chloride;3-acetyl-N-methoxy-N-methylbicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 158630656 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-acetylbicyclo[1.1.1]pentane-1-carbonyl chloride;3-acetyl-N-methoxy-N-methylbicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | CC(=O)C12CC(C(=O)Cl)(C1)C2.CON(C)C(=O)C12CC(C(C)=O)(C1)C2 |
| InChI | InChI=1S/C10H15NO3.C8H9ClO2/c1-7(12)9-4-10(5-9,6-9)8(13)11(2)14-3;1-5(10)7-2-8(3-7,4-7)6(9)11/h4-6H2,1-3H3;2-4H2,1H3 |
| InChIKey | HZDQGESTWVHDDO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|