About carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium
carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium (PubChem CID 158631937) has the molecular formula C23H32O4S
and a molecular weight of 404.57 g/mol. Its IUPAC name is carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium.
Molecular Properties
| Compound Name | carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium |
| PubChem CID | 158631937 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium |
| SMILES | CCC(C)(C)OCCCOC(=O)COc1ccc([SH+]c2ccccc2)cc1.[CH3-] |
| InChI | InChI=1S/C22H28O4S.CH3/c1-4-22(2,3)26-16-8-15-24-21(23)17-25-18-11-13-20(14-12-18)27-19-9-6-5-7-10-19;/h5-7,9-14H,4,8,15-17H2,1-3H3;1H3/q;-1/p+1 |
| InChIKey | HZHNOWWDVJPOES-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium?
The IUPAC name of carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium (CID 158631937) is carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium.
What is the SMILES notation for carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium?
The canonical SMILES for carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium is CCC(C)(C)OCCCOC(=O)COc1ccc([SH+]c2ccccc2)cc1.[CH3-].
What is the InChIKey of carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium?
The InChIKey is HZHNOWWDVJPOES-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H28O4S.CH3/c1-4-22(2,3)26-16-8-15-24-21(23)17-25-18-11-13-20(14-12-18)27-19-9-6-5-7-10-19;/h5-7,9-14H,4,8,15-17H2,1-3H3;1H3/q;-1/p+1.
What are the key properties of carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium?
carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium has a molecular weight of 404.57 g/mol, XLogP of 4.89, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[4-[2-[3-(2-methylbutan-2-yloxy)propoxy]-2-oxoethoxy]phenyl]-phenylsulfanium is sourced from PubChem (CID 158631937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).