About 2-methylbutan-2-yl 2-phenoxyethaneperoxoate
2-methylbutan-2-yl 2-phenoxyethaneperoxoate (PubChem CID 25263513) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-phenoxyethaneperoxoate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 2-phenoxyethaneperoxoate |
| PubChem CID | 25263513 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-methylbutan-2-yl 2-phenoxyethaneperoxoate |
| SMILES | CCC(C)(C)OOC(=O)COc1ccccc1 |
| InChI | InChI=1S/C13H18O4/c1-4-13(2,3)17-16-12(14)10-15-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | PQACISFNSXHXIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 2-phenoxyethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 2-phenoxyethaneperoxoate?
The IUPAC name of 2-methylbutan-2-yl 2-phenoxyethaneperoxoate (CID 25263513) is 2-methylbutan-2-yl 2-phenoxyethaneperoxoate.
What is the SMILES notation for 2-methylbutan-2-yl 2-phenoxyethaneperoxoate?
The canonical SMILES for 2-methylbutan-2-yl 2-phenoxyethaneperoxoate is CCC(C)(C)OOC(=O)COc1ccccc1.
What is the InChIKey of 2-methylbutan-2-yl 2-phenoxyethaneperoxoate?
The InChIKey is PQACISFNSXHXIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-4-13(2,3)17-16-12(14)10-15-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3.
What are the key properties of 2-methylbutan-2-yl 2-phenoxyethaneperoxoate?
2-methylbutan-2-yl 2-phenoxyethaneperoxoate has a molecular weight of 238.28 g/mol, XLogP of 2.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 2-phenoxyethaneperoxoate is sourced from PubChem (CID 25263513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).