C11H12ClNO3 — CID 158632529
4-(2-amino-4-chlorophenyl)-3,3-dideuterio-2-methyl-4-oxobutanoic acid (PubChem CID 158632529) has the molecular formula C11H12ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(2-amino-4-chlorophenyl)-3,3-dideuterio-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-(2-amino-4-chlorophenyl)-3,3-dideuterio-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158632529 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-(2-amino-4-chlorophenyl)-3,3-dideuterio-2-methyl-4-oxobutanoic acid |
| SMILES | [2H]C([2H])(C(=O)c1ccc(Cl)cc1N)C(C)C(=O)O |
| InChI | InChI=1S/C11H12ClNO3/c1-6(11(15)16)4-10(14)8-3-2-7(12)5-9(8)13/h2-3,5-6H,4,13H2,1H3,(H,15,16)/i4D2 |
| InChIKey | WKQZHTAXVFLGMX-APZFVMQVSA-N |
| XLogP | 2.22 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|