C26H48NaO6S+ — CID 158632704
sodium;3-[(3R,5S,6R,7R,10S,13R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl hydrogen sulfate;methane (PubChem CID 158632704) has the molecular formula C26H48NaO6S+ and a molecular weight of 511.72 g/mol. Its IUPAC name is sodium;3-[(3R,5S,6R,7R,10S,13R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl hydrogen sulfate;methane.
| Compound Name | sodium;3-[(3R,5S,6R,7R,10S,13R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl hydrogen sulfate;methane |
|---|---|
| PubChem CID | 158632704 |
| Molecular Formula | C26H48NaO6S+ |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | sodium;3-[(3R,5S,6R,7R,10S,13R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl hydrogen sulfate;methane |
| SMILES | C.CC[C@H]1C(O)C2C3CCC(C(C)CCOS(=O)(=O)O)[C@@]3(C)CCC2[C@@]2(C)CC[C@@H](O)C[C@@H]12.[Na+] |
| InChI | InChI=1S/C25H44O6S.CH4.Na/c1-5-17-21-14-16(26)8-11-25(21,4)20-9-12-24(3)18(6-7-19(24)22(20)23(17)27)15(2)10-13-31-32(28,29)30;;/h15-23,26-27H,5-14H2,1-4H3,(H,28,29,30);1H4;/q;;+1/t15?,16-,17-,18?,19?,20?,21+,22?,23?,24-,25-;;/m1../s1 |
| InChIKey | MXTLYZYNGHTDBP-WPBNYGJDSA-N |
| XLogP | 2.10 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|