C25H43NaO7S — CID 74221781
sodium [(3R)-3-[(3R,5S,6R,7R,10S,12S,13R,17R)-6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl] sulfate (PubChem CID 74221781) has the molecular formula C25H43NaO7S and a molecular weight of 510.67 g/mol. Its IUPAC name is sodium [(3R)-3-[(3R,5S,6R,7R,10S,12S,13R,17R)-6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl] sulfate.
| Compound Name | sodium [(3R)-3-[(3R,5S,6R,7R,10S,12S,13R,17R)-6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl] sulfate |
|---|---|
| PubChem CID | 74221781 |
| Molecular Formula | C25H43NaO7S |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | sodium [(3R)-3-[(3R,5S,6R,7R,10S,12S,13R,17R)-6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl] sulfate |
| SMILES | CC[C@H]1C(O)C2C3CC[C@H]([C@H](C)CCOS(=O)(=O)[O-])[C@@]3(C)[C@@H](O)CC2[C@@]2(C)CC[C@@H](O)C[C@@H]12.[Na+] |
| InChI | InChI=1S/C25H44O7S.Na/c1-5-16-19-12-15(26)8-10-24(19,3)20-13-21(27)25(4)17(6-7-18(25)22(20)23(16)28)14(2)9-11-32-33(29,30)31;/h14-23,26-28H,5-13H2,1-4H3,(H,29,30,31);/q;+1/p-1/t14-,15-,16-,17-,18?,19+,20?,21+,22?,23?,24+,25-;/m1./s1 |
| InChIKey | KAXWKJLMVTUIGJ-NDENKQQASA-M |
| XLogP | 0.09 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|