C31H55NO7S — CID 172517465
2-[4-(6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-propan-2-ylamino]ethanesulfonic acid (PubChem CID 172517465) has the molecular formula C31H55NO7S and a molecular weight of 585.85 g/mol. Its IUPAC name is 2-[4-(6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-propan-2-ylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-propan-2-ylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172517465 |
| Molecular Formula | C31H55NO7S |
| Molecular Weight | 585.85 g/mol |
| Exact Mass | 585.37 |
| IUPAC Name | 2-[4-(6-ethyl-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-propan-2-ylamino]ethanesulfonic acid |
| SMILES | CCC1C(O)C2C(CC(O)C3(C)C(C(C)CCC(=O)N(CCS(=O)(=O)O)C(C)C)CCC23)C2(C)CCC(O)CC12 |
| InChI | InChI=1S/C31H55NO7S/c1-7-21-24-16-20(33)12-13-30(24,5)25-17-26(34)31(6)22(9-10-23(31)28(25)29(21)36)19(4)8-11-27(35)32(18(2)3)14-15-40(37,38)39/h18-26,28-29,33-34,36H,7-17H2,1-6H3,(H,37,38,39) |
| InChIKey | GQECRUNLEDGDJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|