About cobalt(2+);oxalic acid;diacetate
cobalt(2+);oxalic acid;diacetate (PubChem CID 158634462) has the molecular formula C6H8CoO8
and a molecular weight of 267.05 g/mol. Its IUPAC name is cobalt(2+);oxalic acid;diacetate.
Molecular Properties
| Compound Name | cobalt(2+);oxalic acid;diacetate |
| PubChem CID | 158634462 |
| Molecular Formula | C6H8CoO8 |
| Molecular Weight | 267.05 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | cobalt(2+);oxalic acid;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].O=C(O)C(=O)O.[Co+2] |
| InChI | InChI=1S/C2H2O4.2C2H4O2.Co/c3-1(4)2(5)6;2*1-2(3)4;/h(H,3,4)(H,5,6);2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | HZPHKJYUTRJZSH-UHFFFAOYSA-L |
| XLogP | -3.33 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.05 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);oxalic acid;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);oxalic acid;diacetate?
The IUPAC name of cobalt(2+);oxalic acid;diacetate (CID 158634462) is cobalt(2+);oxalic acid;diacetate.
What is the SMILES notation for cobalt(2+);oxalic acid;diacetate?
The canonical SMILES for cobalt(2+);oxalic acid;diacetate is CC(=O)[O-].CC(=O)[O-].O=C(O)C(=O)O.[Co+2].
What is the InChIKey of cobalt(2+);oxalic acid;diacetate?
The InChIKey is HZPHKJYUTRJZSH-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2C2H4O2.Co/c3-1(4)2(5)6;2*1-2(3)4;/h(H,3,4)(H,5,6);2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of cobalt(2+);oxalic acid;diacetate?
cobalt(2+);oxalic acid;diacetate has a molecular weight of 267.05 g/mol, XLogP of -3.33, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);oxalic acid;diacetate is sourced from PubChem (CID 158634462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).