C23H21FN2O5 — CID 158634705
1-(3,4-dimethoxyphenyl)-4-[6-(2-fluoro-4-pyridinyl)-5-methoxy-2-pyridinyl]butane-1,4-dione (PubChem CID 158634705) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-[6-(2-fluoro-4-pyridinyl)-5-methoxy-2-pyridinyl]butane-1,4-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-[6-(2-fluoro-4-pyridinyl)-5-methoxy-2-pyridinyl]butane-1,4-dione |
|---|---|
| PubChem CID | 158634705 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-[6-(2-fluoro-4-pyridinyl)-5-methoxy-2-pyridinyl]butane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2ccc(OC)c(-c3ccnc(F)c3)n2)cc1OC |
| InChI | InChI=1S/C23H21FN2O5/c1-29-19-8-4-14(12-21(19)31-3)17(27)6-7-18(28)16-5-9-20(30-2)23(26-16)15-10-11-25-22(24)13-15/h4-5,8-13H,6-7H2,1-3H3 |
| InChIKey | HZPYWHJARBXWOL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|