C14H10O6 — CID 158634901
[2,6-dihydroxy-3-(2-hydroxybenzoyl)phenyl] formate (PubChem CID 158634901) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is [2,6-dihydroxy-3-(2-hydroxybenzoyl)phenyl] formate.
| Compound Name | [2,6-dihydroxy-3-(2-hydroxybenzoyl)phenyl] formate |
|---|---|
| PubChem CID | 158634901 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [2,6-dihydroxy-3-(2-hydroxybenzoyl)phenyl] formate |
| SMILES | O=COc1c(O)ccc(C(=O)c2ccccc2O)c1O |
| InChI | InChI=1S/C14H10O6/c15-7-20-14-11(17)6-5-9(13(14)19)12(18)8-3-1-2-4-10(8)16/h1-7,16-17,19H |
| InChIKey | BMGSLUWRLKXIST-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|