C37H52O10Si — CID 158635015
[(4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 158635015) has the molecular formula C37H52O10Si and a molecular weight of 684.90 g/mol. Its IUPAC name is [(4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 158635015 |
| Molecular Formula | C37H52O10Si |
| Molecular Weight | 684.90 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | [(4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2OC[C@@]2(OC(C)=O)C2C(OC(=O)c3ccccc3)C3C[C@H](O)C(C)=C([C@@H](OC(C)=O)C(=O)[C@@]21C)C3(C)C |
| InChI | InChI=1S/C37H52O10Si/c1-10-48(11-2,12-3)47-27-19-28-37(20-43-28,46-23(6)39)32-30(45-34(42)24-16-14-13-15-17-24)25-18-26(40)21(4)29(35(25,7)8)31(44-22(5)38)33(41)36(27,32)9/h13-17,25-28,30-32,40H,10-12,18-20H2,1-9H3/t25?,26-,27-,28+,30?,31+,32?,36+,37-/m0/s1 |
| InChIKey | YCUACIHFZNRXQV-OGGFRIJISA-N |
| XLogP | 5.57 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.90 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|