C31H37FO9 — CID 59050648
[(2R,4S,7R,10R,12R,15S)-4,12-diacetyloxy-9-fluoro-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59050648) has the molecular formula C31H37FO9 and a molecular weight of 572.63 g/mol. Its IUPAC name is [(2R,4S,7R,10R,12R,15S)-4,12-diacetyloxy-9-fluoro-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(2R,4S,7R,10R,12R,15S)-4,12-diacetyloxy-9-fluoro-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59050648 |
| Molecular Formula | C31H37FO9 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | [(2R,4S,7R,10R,12R,15S)-4,12-diacetyloxy-9-fluoro-15-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@]2(C)C(F)C[C@H]3OC[C@@]3(OC(C)=O)C2C(OC(=O)c2ccccc2)C2C[C@H](O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C31H37FO9/c1-15-20(35)12-19-24(40-28(37)18-10-8-7-9-11-18)26-30(6,21(32)13-22-31(26,14-38-22)41-17(3)34)27(36)25(39-16(2)33)23(15)29(19,4)5/h7-11,19-22,24-26,35H,12-14H2,1-6H3/t19?,20-,21?,22+,24?,25+,26?,30+,31-/m0/s1 |
| InChIKey | OORUKAVRFTXXKO-IPMBIGJHSA-N |
| XLogP | 3.51 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|