C17H18AcF3IN7- — CID 158636207
actinium;iodomethane;2-[6-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]ethylazanide (PubChem CID 158636207) has the molecular formula C17H18AcF3IN7- and a molecular weight of 731.28 g/mol. Its IUPAC name is actinium;iodomethane;2-[6-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]ethylazanide.
| Compound Name | actinium;iodomethane;2-[6-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]ethylazanide |
|---|---|
| PubChem CID | 158636207 |
| Molecular Formula | C17H18AcF3IN7- |
| Molecular Weight | 731.28 g/mol |
| Exact Mass | 731.09 |
| IUPAC Name | actinium;iodomethane;2-[6-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]ethylazanide |
| SMILES | CI.Cc1nc(Nc2cc(CC[NH-])nc(-c3ccccc3C(F)(F)F)n2)n[nH]1.[Ac] |
| InChI | InChI=1S/C16H15F3N7.CH3I.Ac/c1-9-21-15(26-25-9)24-13-8-10(6-7-20)22-14(23-13)11-4-2-3-5-12(11)16(17,18)19;1-2;/h2-5,8,20H,6-7H2,1H3,(H2,21,22,23,24,25,26);1H3;/q-1;; |
| InChIKey | QGFTWBDUWXVJKT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|