About CID 158637073
CID 158637073 (PubChem CID 158637073) has the molecular formula C18H13B37ClFN
and a molecular weight of 697.80 g/mol.
Molecular Properties
| Compound Name | CID 158637073 |
| PubChem CID | 158637073 |
| Molecular Formula | C18H13B37ClFN |
| Molecular Weight | 697.80 g/mol |
| Exact Mass | 704.42 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)ncc1-c1ccc(F)cc1.[B][B]B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C18H13ClFN.B37/c1-12-10-18(14-2-6-15(19)7-3-14)21-11-17(12)13-4-8-16(20)9-5-13;1-20-30(21(2)3)35(31(22(4)5)23(6)7)37(34(28(16)17)29(18)19)36(32(24(8)9)25(10)11)33(26(12)13)27(14)15/h2-11H,1H3; |
| InChIKey | RUTOTLVNIAATPB-UHFFFAOYSA-N |
| XLogP | -8.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 697.80 |
| LogP ≤ 5 | -8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158637073 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158637073?
The IUPAC name of CID 158637073 (CID 158637073) is not available.
What is the SMILES notation for CID 158637073?
The canonical SMILES for CID 158637073 is Cc1cc(-c2ccc(Cl)cc2)ncc1-c1ccc(F)cc1.[B][B]B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].
What is the InChIKey of CID 158637073?
The InChIKey is RUTOTLVNIAATPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClFN.B37/c1-12-10-18(14-2-6-15(19)7-3-14)21-11-17(12)13-4-8-16(20)9-5-13;1-20-30(21(2)3)35(31(22(4)5)23(6)7)37(34(28(16)17)29(18)19)36(32(24(8)9)25(10)11)33(26(12)13)27(14)15/h2-11H,1H3;.
What are the key properties of CID 158637073?
CID 158637073 has a molecular weight of 697.80 g/mol, XLogP of -8.57, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158637073 is sourced from PubChem (CID 158637073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).