C19H16FN — CID 142308493
5-(4-fluorophenyl)-4-methyl-2-(4-methylphenyl)pyridine (PubChem CID 142308493) has the molecular formula C19H16FN and a molecular weight of 277.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-methyl-2-(4-methylphenyl)pyridine.
| Compound Name | 5-(4-fluorophenyl)-4-methyl-2-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 142308493 |
| Molecular Formula | C19H16FN |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 5-(4-fluorophenyl)-4-methyl-2-(4-methylphenyl)pyridine |
| SMILES | Cc1ccc(-c2cc(C)c(-c3ccc(F)cc3)cn2)cc1 |
| InChI | InChI=1S/C19H16FN/c1-13-3-5-16(6-4-13)19-11-14(2)18(12-21-19)15-7-9-17(20)10-8-15/h3-12H,1-2H3 |
| InChIKey | BUCKDNMBQKMAIR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |