C17H14FN — CID 134869171
4-(4-fluorophenyl)-1,7-dimethylisoquinoline (PubChem CID 134869171) has the molecular formula C17H14FN and a molecular weight of 251.30 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,7-dimethylisoquinoline.
| Compound Name | 4-(4-fluorophenyl)-1,7-dimethylisoquinoline |
|---|---|
| PubChem CID | 134869171 |
| Molecular Formula | C17H14FN |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-(4-fluorophenyl)-1,7-dimethylisoquinoline |
| SMILES | Cc1ccc2c(-c3ccc(F)cc3)cnc(C)c2c1 |
| InChI | InChI=1S/C17H14FN/c1-11-3-8-15-16(9-11)12(2)19-10-17(15)13-4-6-14(18)7-5-13/h3-10H,1-2H3 |
| InChIKey | ISMAYRSOXZPPRA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |