About 6-butanoyloxyhex-2-enoic acid
6-butanoyloxyhex-2-enoic acid (PubChem CID 158638113) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 6-butanoyloxyhex-2-enoic acid.
Molecular Properties
| Compound Name | 6-butanoyloxyhex-2-enoic acid |
| PubChem CID | 158638113 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 6-butanoyloxyhex-2-enoic acid |
| SMILES | CCCC(=O)OCCCC=CC(=O)O |
| InChI | InChI=1S/C10H16O4/c1-2-6-10(13)14-8-5-3-4-7-9(11)12/h4,7H,2-3,5-6,8H2,1H3,(H,11,12) |
| InChIKey | PRRHFOCXGSGGBV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-butanoyloxyhex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butanoyloxyhex-2-enoic acid?
The IUPAC name of 6-butanoyloxyhex-2-enoic acid (CID 158638113) is 6-butanoyloxyhex-2-enoic acid.
What is the SMILES notation for 6-butanoyloxyhex-2-enoic acid?
The canonical SMILES for 6-butanoyloxyhex-2-enoic acid is CCCC(=O)OCCCC=CC(=O)O.
What is the InChIKey of 6-butanoyloxyhex-2-enoic acid?
The InChIKey is PRRHFOCXGSGGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-2-6-10(13)14-8-5-3-4-7-9(11)12/h4,7H,2-3,5-6,8H2,1H3,(H,11,12).
What are the key properties of 6-butanoyloxyhex-2-enoic acid?
6-butanoyloxyhex-2-enoic acid has a molecular weight of 200.23 g/mol, XLogP of 1.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butanoyloxyhex-2-enoic acid is sourced from PubChem (CID 158638113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).