C38H72O14Si4 — CID 158638195
ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate;methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate (PubChem CID 158638195) has the molecular formula C38H72O14Si4 and a molecular weight of 865.32 g/mol. Its IUPAC name is ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate;methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate.
| Compound Name | ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate;methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
|---|---|
| PubChem CID | 158638195 |
| Molecular Formula | C38H72O14Si4 |
| Molecular Weight | 865.32 g/mol |
| Exact Mass | 864.40 |
| IUPAC Name | ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate;methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)C(=O)OCC.COC(=O)C(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C20H38O7Si2.C18H34O7Si2/c1-7-25-19(23)17(21)13-9-11-15-28(3,4)27-29(5,6)16-12-10-14-18(22)20(24)26-8-2;1-23-17(21)15(19)11-7-9-13-26(3,4)25-27(5,6)14-10-8-12-16(20)18(22)24-2/h7-16H2,1-6H3;7-14H2,1-6H3 |
| InChIKey | IAAOMAYOJCGUBC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.32 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|