C37H36N8O7 — CID 158642895
(4-benzylpiperazin-1-yl)-[4-[methyl-(5-nitro-2-pyridinyl)amino]phenyl]methanone;4-[methyl-(5-nitro-2-pyridinyl)amino]benzoic acid (PubChem CID 158642895) has the molecular formula C37H36N8O7 and a molecular weight of 704.74 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[4-[methyl-(5-nitro-2-pyridinyl)amino]phenyl]methanone;4-[methyl-(5-nitro-2-pyridinyl)amino]benzoic acid.
| Compound Name | (4-benzylpiperazin-1-yl)-[4-[methyl-(5-nitro-2-pyridinyl)amino]phenyl]methanone;4-[methyl-(5-nitro-2-pyridinyl)amino]benzoic acid |
|---|---|
| PubChem CID | 158642895 |
| Molecular Formula | C37H36N8O7 |
| Molecular Weight | 704.74 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[4-[methyl-(5-nitro-2-pyridinyl)amino]phenyl]methanone;4-[methyl-(5-nitro-2-pyridinyl)amino]benzoic acid |
| SMILES | CN(c1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cc1)c1ccc([N+](=O)[O-])cn1.CN(c1ccc(C(=O)O)cc1)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C24H25N5O3.C13H11N3O4/c1-26(23-12-11-22(17-25-23)29(31)32)21-9-7-20(8-10-21)24(30)28-15-13-27(14-16-28)18-19-5-3-2-4-6-19;1-15(10-4-2-9(3-5-10)13(17)18)12-7-6-11(8-14-12)16(19)20/h2-12,17H,13-16,18H2,1H3;2-8H,1H3,(H,17,18) |
| InChIKey | IAPMNCOVQWRBRR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 179.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|