C43H30N2O2 — CID 158644763
2-[(2E)-2-(9,9-dimethyl-1,3-diphenylindeno[1,2-f]benzimidazol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 158644763) has the molecular formula C43H30N2O2 and a molecular weight of 606.73 g/mol. Its IUPAC name is 2-[(2E)-2-(9,9-dimethyl-1,3-diphenylindeno[1,2-f]benzimidazol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2E)-2-(9,9-dimethyl-1,3-diphenylindeno[1,2-f]benzimidazol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 158644763 |
| Molecular Formula | C43H30N2O2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-[(2E)-2-(9,9-dimethyl-1,3-diphenylindeno[1,2-f]benzimidazol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)N(c1ccccc1)/C(=C\C=C1C(=O)c2cc4ccccc4cc2C1=O)N3c1ccccc1 |
| InChI | InChI=1S/C43H30N2O2/c1-43(2)36-20-12-11-19-31(36)33-25-38-39(26-37(33)43)45(30-17-7-4-8-18-30)40(44(38)29-15-5-3-6-16-29)22-21-32-41(46)34-23-27-13-9-10-14-28(27)24-35(34)42(32)47/h3-26H,1-2H3/b40-22- |
| InChIKey | UQGKXZFTIPLQAY-BOABNOFISA-N |
| XLogP | 10.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|