C23H30FN5O2 — CID 158645095
5-(dimethylamino)-1-[4-(4-fluoro-2-propan-2-yloxyanilino)-5-methylpyrrolo[3,2-d]pyrimidin-6-yl]pentan-1-one (PubChem CID 158645095) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 5-(dimethylamino)-1-[4-(4-fluoro-2-propan-2-yloxyanilino)-5-methylpyrrolo[3,2-d]pyrimidin-6-yl]pentan-1-one.
| Compound Name | 5-(dimethylamino)-1-[4-(4-fluoro-2-propan-2-yloxyanilino)-5-methylpyrrolo[3,2-d]pyrimidin-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 158645095 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 5-(dimethylamino)-1-[4-(4-fluoro-2-propan-2-yloxyanilino)-5-methylpyrrolo[3,2-d]pyrimidin-6-yl]pentan-1-one |
| SMILES | CC(C)Oc1cc(F)ccc1Nc1ncnc2cc(C(=O)CCCCN(C)C)n(C)c12 |
| InChI | InChI=1S/C23H30FN5O2/c1-15(2)31-21-12-16(24)9-10-17(21)27-23-22-18(25-14-26-23)13-19(29(22)5)20(30)8-6-7-11-28(3)4/h9-10,12-15H,6-8,11H2,1-5H3,(H,25,26,27) |
| InChIKey | IAWBSYOQSWQINX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|