C20H28ClF3N4O2 — CID 158645104
5-(4-chloro-1,3-diethylpyrazol-5-yl)-4-propan-2-yl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;nitrous acid (PubChem CID 158645104) has the molecular formula C20H28ClF3N4O2 and a molecular weight of 448.92 g/mol. Its IUPAC name is 5-(4-chloro-1,3-diethylpyrazol-5-yl)-4-propan-2-yl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;nitrous acid.
| Compound Name | 5-(4-chloro-1,3-diethylpyrazol-5-yl)-4-propan-2-yl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;nitrous acid |
|---|---|
| PubChem CID | 158645104 |
| Molecular Formula | C20H28ClF3N4O2 |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 5-(4-chloro-1,3-diethylpyrazol-5-yl)-4-propan-2-yl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;nitrous acid |
| SMILES | CCc1nn(CC)c(-c2cnc(CC(C)(C)C(F)(F)F)cc2C(C)C)c1Cl.O=NO |
| InChI | InChI=1S/C20H27ClF3N3.HNO2/c1-7-16-17(21)18(27(8-2)26-16)15-11-25-13(9-14(15)12(3)4)10-19(5,6)20(22,23)24;2-1-3/h9,11-12H,7-8,10H2,1-6H3;(H,2,3) |
| InChIKey | IAWCIDBYFUMOSK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|