C15H21ClN3O+ — CID 153296616
3-(4-chloro-1,3-diethylpyrazol-5-yl)-1-hydroxy-4-propan-2-ylpyridin-1-ium (PubChem CID 153296616) has the molecular formula C15H21ClN3O+ and a molecular weight of 294.81 g/mol. Its IUPAC name is 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1-hydroxy-4-propan-2-ylpyridin-1-ium.
| Compound Name | 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1-hydroxy-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 153296616 |
| Molecular Formula | C15H21ClN3O+ |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1-hydroxy-4-propan-2-ylpyridin-1-ium |
| SMILES | CCc1nn(CC)c(-c2c[n+](O)ccc2C(C)C)c1Cl |
| InChI | InChI=1S/C15H21ClN3O/c1-5-13-14(16)15(19(6-2)17-13)12-9-18(20)8-7-11(12)10(3)4/h7-10,20H,5-6H2,1-4H3/q+1 |
| InChIKey | APPHYYRWGBMZLZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|