C17H22BrClN2 — CID 104846518
5-(3-bromo-2-methyl-3-phenylpropyl)-4-chloro-1,3-diethylpyrazole (PubChem CID 104846518) has the molecular formula C17H22BrClN2 and a molecular weight of 369.73 g/mol. Its IUPAC name is 5-(3-bromo-2-methyl-3-phenylpropyl)-4-chloro-1,3-diethylpyrazole.
| Compound Name | 5-(3-bromo-2-methyl-3-phenylpropyl)-4-chloro-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 104846518 |
| Molecular Formula | C17H22BrClN2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-(3-bromo-2-methyl-3-phenylpropyl)-4-chloro-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(CC(C)C(Br)c2ccccc2)c1Cl |
| InChI | InChI=1S/C17H22BrClN2/c1-4-14-17(19)15(21(5-2)20-14)11-12(3)16(18)13-9-7-6-8-10-13/h6-10,12,16H,4-5,11H2,1-3H3 |
| InChIKey | XJTVRAIPMTVEKD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|