C13H13Cl2F2N3O — CID 153296742
6-chloro-3-(4-chloro-1,3-diethylpyrazol-5-yl)-2-(difluoromethoxy)pyridine (PubChem CID 153296742) has the molecular formula C13H13Cl2F2N3O and a molecular weight of 336.17 g/mol. Its IUPAC name is 6-chloro-3-(4-chloro-1,3-diethylpyrazol-5-yl)-2-(difluoromethoxy)pyridine.
| Compound Name | 6-chloro-3-(4-chloro-1,3-diethylpyrazol-5-yl)-2-(difluoromethoxy)pyridine |
|---|---|
| PubChem CID | 153296742 |
| Molecular Formula | C13H13Cl2F2N3O |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 6-chloro-3-(4-chloro-1,3-diethylpyrazol-5-yl)-2-(difluoromethoxy)pyridine |
| SMILES | CCc1nn(CC)c(-c2ccc(Cl)nc2OC(F)F)c1Cl |
| InChI | InChI=1S/C13H13Cl2F2N3O/c1-3-8-10(15)11(20(4-2)19-8)7-5-6-9(14)18-12(7)21-13(16)17/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | YRPBJOQMUYFOHF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|