C12H12ClF2N3O — CID 153296811
3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-4-(difluoromethoxy)pyridine (PubChem CID 153296811) has the molecular formula C12H12ClF2N3O and a molecular weight of 287.70 g/mol. Its IUPAC name is 3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-4-(difluoromethoxy)pyridine.
| Compound Name | 3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-4-(difluoromethoxy)pyridine |
|---|---|
| PubChem CID | 153296811 |
| Molecular Formula | C12H12ClF2N3O |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-4-(difluoromethoxy)pyridine |
| SMILES | CCc1nn(C)c(-c2cnccc2OC(F)F)c1Cl |
| InChI | InChI=1S/C12H12ClF2N3O/c1-3-8-10(13)11(18(2)17-8)7-6-16-5-4-9(7)19-12(14)15/h4-6,12H,3H2,1-2H3 |
| InChIKey | UXFOISOCQIQVCR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |