C35H47N3O6S — CID 158646042
6-[[4-[2-[1-[2-(N,3-diethylanilino)-2-oxoethyl]indol-2-yl]-2-oxoethyl]cyclohexanecarbonyl]amino]hexane-1-sulfonic acid (PubChem CID 158646042) has the molecular formula C35H47N3O6S and a molecular weight of 637.84 g/mol. Its IUPAC name is 6-[[4-[2-[1-[2-(N,3-diethylanilino)-2-oxoethyl]indol-2-yl]-2-oxoethyl]cyclohexanecarbonyl]amino]hexane-1-sulfonic acid.
| Compound Name | 6-[[4-[2-[1-[2-(N,3-diethylanilino)-2-oxoethyl]indol-2-yl]-2-oxoethyl]cyclohexanecarbonyl]amino]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 158646042 |
| Molecular Formula | C35H47N3O6S |
| Molecular Weight | 637.84 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | 6-[[4-[2-[1-[2-(N,3-diethylanilino)-2-oxoethyl]indol-2-yl]-2-oxoethyl]cyclohexanecarbonyl]amino]hexane-1-sulfonic acid |
| SMILES | CCc1cccc(N(CC)C(=O)Cn2c(C(=O)CC3CCC(C(=O)NCCCCCCS(=O)(=O)O)CC3)cc3ccccc32)c1 |
| InChI | InChI=1S/C35H47N3O6S/c1-3-26-12-11-14-30(22-26)37(4-2)34(40)25-38-31-15-8-7-13-29(31)24-32(38)33(39)23-27-16-18-28(19-17-27)35(41)36-20-9-5-6-10-21-45(42,43)44/h7-8,11-15,22,24,27-28H,3-6,9-10,16-21,23,25H2,1-2H3,(H,36,41)(H,42,43,44) |
| InChIKey | GQMCMTJNRZJCFL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.84 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|