C18H28N4O3S — CID 158647344
methane;morpholine;8-morpholin-4-yl-6-sulfanylidene-1,3,4,7-tetrahydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 158647344) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is methane;morpholine;8-morpholin-4-yl-6-sulfanylidene-1,3,4,7-tetrahydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | methane;morpholine;8-morpholin-4-yl-6-sulfanylidene-1,3,4,7-tetrahydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 158647344 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | methane;morpholine;8-morpholin-4-yl-6-sulfanylidene-1,3,4,7-tetrahydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | C.C1COCCN1.N#Cc1c2c(c(N3CCOCC3)[nH]c1=S)COCC2 |
| InChI | InChI=1S/C13H15N3O2S.C4H9NO.CH4/c14-7-10-9-1-4-18-8-11(9)12(15-13(10)19)16-2-5-17-6-3-16;1-3-6-4-2-5-1;/h1-6,8H2,(H,15,19);5H,1-4H2;1H4 |
| InChIKey | IBDACQWQVOGRES-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|