About dimethyl sulfate;phenol;piperazine
dimethyl sulfate;phenol;piperazine (PubChem CID 158647991) has the molecular formula C12H22N2O5S
and a molecular weight of 306.38 g/mol. Its IUPAC name is dimethyl sulfate;phenol;piperazine.
Molecular Properties
| Compound Name | dimethyl sulfate;phenol;piperazine |
| PubChem CID | 158647991 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | dimethyl sulfate;phenol;piperazine |
| SMILES | C1CNCCN1.COS(=O)(=O)OC.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C4H10N2.C2H6O4S/c7-6-4-2-1-3-5-6;1-2-6-4-3-5-1;1-5-7(3,4)6-2/h1-5,7H;5-6H,1-4H2;1-2H3 |
| InChIKey | IBEXPAJZGWLXES-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl sulfate;phenol;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl sulfate;phenol;piperazine?
The IUPAC name of dimethyl sulfate;phenol;piperazine (CID 158647991) is dimethyl sulfate;phenol;piperazine.
What is the SMILES notation for dimethyl sulfate;phenol;piperazine?
The canonical SMILES for dimethyl sulfate;phenol;piperazine is C1CNCCN1.COS(=O)(=O)OC.Oc1ccccc1.
What is the InChIKey of dimethyl sulfate;phenol;piperazine?
The InChIKey is IBEXPAJZGWLXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C4H10N2.C2H6O4S/c7-6-4-2-1-3-5-6;1-2-6-4-3-5-1;1-5-7(3,4)6-2/h1-5,7H;5-6H,1-4H2;1-2H3.
What are the key properties of dimethyl sulfate;phenol;piperazine?
dimethyl sulfate;phenol;piperazine has a molecular weight of 306.38 g/mol, XLogP of 0.10, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl sulfate;phenol;piperazine is sourced from PubChem (CID 158647991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).