C14H20F6N4O5 — CID 158648372
N-(1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 158648372) has the molecular formula C14H20F6N4O5 and a molecular weight of 438.33 g/mol. Its IUPAC name is N-(1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 158648372 |
| Molecular Formula | C14H20F6N4O5 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NC1=NCCCN1)C1CCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N4O.2C2HF3O2/c15-9(8-2-6-11-7-3-8)14-10-12-4-1-5-13-10;2*3-2(4,5)1(6)7/h8,11H,1-7H2,(H2,12,13,14,15);2*(H,6,7) |
| InChIKey | IBGCYNYIPFTLML-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |