C8H15N5 — CID 14063729
N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 14063729) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 14063729 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C1CN=C(NC2=NCCCN2)NC1 |
| InChI | InChI=1S/C8H15N5/c1-3-9-7(10-4-1)13-8-11-5-2-6-12-8/h1-6H2,(H3,9,10,11,12,13) |
| InChIKey | JXWAHFHOPHMMAE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |