C7H11N3O — CID 152756178
N-(1,4,5,6-tetrahydropyrimidin-2-yl)prop-2-enamide (PubChem CID 152756178) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is N-(1,4,5,6-tetrahydropyrimidin-2-yl)prop-2-enamide.
| Compound Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 152756178 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N-(1,4,5,6-tetrahydropyrimidin-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1=NCCCN1 |
| InChI | InChI=1S/C7H11N3O/c1-2-6(11)10-7-8-4-3-5-9-7/h2H,1,3-5H2,(H2,8,9,10,11) |
| InChIKey | SFOPQAIVUNLYMH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|