C7H14N4O — CID 10012329
N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propanehydrazide (PubChem CID 10012329) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propanehydrazide.
| Compound Name | N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 10012329 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propanehydrazide |
| SMILES | CCC(=O)NNC1=NCCCN1 |
| InChI | InChI=1S/C7H14N4O/c1-2-6(12)10-11-7-8-4-3-5-9-7/h2-5H2,1H3,(H,10,12)(H2,8,9,11) |
| InChIKey | SPUDUJPTSNTOSZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|